ChemNet > CAS > 499770-99-9 1-Methyl-1H-imidazol-5-yl isocyanate
499770-99-9 1-Methyl-1H-imidazol-5-yl isocyanate
| 상품명칭 |
1-Methyl-1H-imidazol-5-yl isocyanate |
| 별명 |
5-isocyanato-1-methyl-1H-imidazole |
| 분자식 |
C5H5N3O |
| 분자량 |
123.1127 |
| InChI |
InChI=1/C5H5N3O/c1-8-3-6-2-5(8)7-4-9/h2-3H,1H3 |
| cas번호 |
499770-99-9 |
| 분자 구조 |
|
| 밀도 |
1.22g/cm3 |
| 녹는 점 |
40.5℃ |
| 비등점 |
263.1°C at 760 mmHg |
| 굴절 지수 |
1.584 |
| 인화점 |
112.9°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
